* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10871766 |
English Synonyms: | SELENA SEL10871766 |
MDL Number.: | MFCD16835227 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(CC#N)NS(=O)(=O)c1cccs1 |
InChi: | InChI=1S/C9H12N2O2S2/c1-2-8(5-6-10)11-15(12,13)9-4-3-7-14-9/h3-4,7-8,11H,2,5H2,1H3 |
InChiKey: | InChIKey=WEGVYMTYYOCRCW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.