* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028230 |
English Synonyms: | ABAMACHEM ABA-6028230 |
MDL Number.: | MFCD16835231 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCC(CC#N)NS(=O)(=O)c1cccnc1 |
InChi: | InChI=1S/C10H13N3O2S/c1-2-9(5-6-11)13-16(14,15)10-4-3-7-12-8-10/h3-4,7-9,13H,2,5H2,1H3 |
InChiKey: | InChIKey=SPISOIXPYAZPTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.