* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028236 |
English Synonyms: | ABAMACHEM ABA-6028236 |
MDL Number.: | MFCD16835889 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)Cl)S(=O)(=O)CCCN=[N+]=[N-] |
InChi: | InChI=1S/C9H10ClN3O2S/c10-8-3-1-4-9(7-8)16(14,15)6-2-5-12-13-11/h1,3-4,7H,2,5-6H2 |
InChiKey: | InChIKey=WYVMKWOCLIVFAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.