* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-([2-(ETHYLAMINO)ETHYL]AMINO)-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DIONE |
English Synonyms: | 6-([2-(ETHYLAMINO)ETHYL]AMINO)-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DIONE |
MDL Number.: | MFCD16838724 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CCNCCNc1c(=O)[nH]c(=O)[nH]n1 |
InChi: | InChI=1S/C7H13N5O2/c1-2-8-3-4-9-5-6(13)10-7(14)12-11-5/h8H,2-4H2,1H3,(H,9,11)(H2,10,12,13,14) |
InChiKey: | InChIKey=WDQWORHPWGDXQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.