* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL[2-(([1,2,3,4]TETRAZOLO[1,5-A]PYRAZIN-5-YL)AMINO)ETHYL]AMINE |
| English Synonyms: | PROPYL[2-(([1,2,3,4]TETRAZOLO[1,5-A]PYRAZIN-5-YL)AMINO)ETHYL]AMINE |
| MDL Number.: | MFCD16838764 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCCNCCNc1cncc2n1nnn2 |
| InChi: | InChI=1S/C9H15N7/c1-2-3-10-4-5-12-8-6-11-7-9-13-14-15-16(8)9/h6-7,10,12H,2-5H2,1H3 |
| InChiKey: | InChIKey=VLAPYXMJUIUXHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.