* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-([2-(PROPYLAMINO)ETHYL]AMINO)-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DIONE |
English Synonyms: | 6-([2-(PROPYLAMINO)ETHYL]AMINO)-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DIONE |
MDL Number.: | MFCD16838801 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CCCNCCNc1c(=O)[nH]c(=O)[nH]n1 |
InChi: | InChI=1S/C8H15N5O2/c1-2-3-9-4-5-10-6-7(14)11-8(15)13-12-6/h9H,2-5H2,1H3,(H,10,12)(H2,11,13,14,15) |
InChiKey: | InChIKey=JTOZEHBNIQDVOS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.