* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-((2-[(PROPAN-2-YL)AMINO]ETHYL)AMINO)-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DIONE |
| English Synonyms: | 6-((2-[(PROPAN-2-YL)AMINO]ETHYL)AMINO)-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DIONE |
| MDL Number.: | MFCD16838863 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | CC(C)NCCNc1c(=O)[nH]c(=O)[nH]n1 |
| InChi: | InChI=1S/C8H15N5O2/c1-5(2)9-3-4-10-6-7(14)11-8(15)13-12-6/h5,9H,3-4H2,1-2H3,(H,10,12)(H2,11,13,14,15) |
| InChiKey: | InChIKey=UUPVRFZPAGYTPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.