* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTYL 2-(PIPERIDIN-3-YL)ACETATE |
| English Synonyms: | BUTYL 2-(PIPERIDIN-3-YL)ACETATE |
| MDL Number.: | MFCD16839444 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCOC(=O)CC1CCCNC1 |
| InChi: | InChI=1S/C11H21NO2/c1-2-3-7-14-11(13)8-10-5-4-6-12-9-10/h10,12H,2-9H2,1H3 |
| InChiKey: | InChIKey=FUUGJNGODWMZNN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.