* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTAN-2-YL 2-(PIPERIDIN-3-YL)ACETATE |
| English Synonyms: | BUTAN-2-YL 2-(PIPERIDIN-3-YL)ACETATE |
| MDL Number.: | MFCD16839446 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(C)OC(=O)CC1CCCNC1 |
| InChi: | InChI=1S/C11H21NO2/c1-3-9(2)14-11(13)7-10-5-4-6-12-8-10/h9-10,12H,3-8H2,1-2H3 |
| InChiKey: | InChIKey=WLWNOZKBTDRXGI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.