* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HEXYL 2-(PIPERIDIN-3-YL)ACETATE |
| English Synonyms: | HEXYL 2-(PIPERIDIN-3-YL)ACETATE |
| MDL Number.: | MFCD16839460 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCCOC(=O)CC1CCCNC1 |
| InChi: | InChI=1S/C13H25NO2/c1-2-3-4-5-9-16-13(15)10-12-7-6-8-14-11-12/h12,14H,2-11H2,1H3 |
| InChiKey: | InChIKey=HAQAOIOFCJUBPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.