* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OXAN-4-YL 2-(PIPERIDIN-3-YL)ACETATE |
English Synonyms: | OXAN-4-YL 2-(PIPERIDIN-3-YL)ACETATE |
MDL Number.: | MFCD16839462 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C1CC(CNC1)CC(=O)OC2CCOCC2 |
InChi: | InChI=1S/C12H21NO3/c14-12(8-10-2-1-5-13-9-10)16-11-3-6-15-7-4-11/h10-11,13H,1-9H2 |
InChiKey: | InChIKey=PMIRELWPQXXFLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.