* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6294672 |
English Synonyms: | ABAMACHEM ABA-6294672 |
MDL Number.: | MFCD16841832 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(sc1S(=O)(=O)NCCCC#N)Br |
InChi: | InChI=1S/C8H9BrN2O2S2/c9-7-3-4-8(14-7)15(12,13)11-6-2-1-5-10/h3-4,11H,1-2,6H2 |
InChiKey: | InChIKey=OUIXTYBBVOZHML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.