* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC1132697 |
| English Synonyms: | BCH-RESEARCH BC1132697 |
| MDL Number.: | MFCD16841833 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1S(=O)(=O)NCCCC#N)Br |
| InChi: | InChI=1S/C10H11BrN2O2S/c11-9-3-5-10(6-4-9)16(14,15)13-8-2-1-7-12/h3-6,13H,1-2,8H2 |
| InChiKey: | InChIKey=OOXVMXUZVFQQLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.