* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028360 |
English Synonyms: | ABAMACHEM ABA-6028360 |
MDL Number.: | MFCD16843224 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | c1cnc(c(n1)C#N)N2CCS(=O)(=O)CC2 |
InChi: | InChI=1S/C9H10N4O2S/c10-7-8-9(12-2-1-11-8)13-3-5-16(14,15)6-4-13/h1-2H,3-6H2 |
InChiKey: | InChIKey=MKLQYPBOOKYJNA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.