* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(BUT-3-ENAMIDO)HEXANOIC ACID |
English Synonyms: | 6-(BUT-3-ENAMIDO)HEXANOIC ACID |
MDL Number.: | MFCD16843812 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C=CCC(=O)NCCCCCC(=O)O |
InChi: | InChI=1S/C10H17NO3/c1-2-6-9(12)11-8-5-3-4-7-10(13)14/h2H,1,3-8H2,(H,11,12)(H,13,14) |
InChiKey: | InChIKey=QADGLZHIDONRIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.