* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(PENT-4-ENAMIDO)HEPTANOIC ACID |
| English Synonyms: | 7-(PENT-4-ENAMIDO)HEPTANOIC ACID |
| MDL Number.: | MFCD16843878 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C=CCCC(=O)NCCCCCCC(=O)O |
| InChi: | InChI=1S/C12H21NO3/c1-2-3-8-11(14)13-10-7-5-4-6-9-12(15)16/h2H,1,3-10H2,(H,13,14)(H,15,16) |
| InChiKey: | InChIKey=RPXVPLIWNADMCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.