* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL 2-[2-(BUT-3-ENAMIDO)-1,3-THIAZOL-4-YL]ACETATE |
| English Synonyms: | METHYL 2-[2-(BUT-3-ENAMIDO)-1,3-THIAZOL-4-YL]ACETATE |
| MDL Number.: | MFCD16844319 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COC(=O)Cc1csc(n1)NC(=O)CC=C |
| InChi: | InChI=1S/C10H12N2O3S/c1-3-4-8(13)12-10-11-7(6-16-10)5-9(14)15-2/h3,6H,1,4-5H2,2H3,(H,11,12,13) |
| InChiKey: | InChIKey=HPNPIGFOFJQPRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.