* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL 2-(BUT-3-ENAMIDO)ACETATE |
| English Synonyms: | METHYL 2-(BUT-3-ENAMIDO)ACETATE |
| MDL Number.: | MFCD16844328 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COC(=O)CNC(=O)CC=C |
| InChi: | InChI=1S/C7H11NO3/c1-3-4-6(9)8-5-7(10)11-2/h3H,1,4-5H2,2H3,(H,8,9) |
| InChiKey: | InChIKey=MGICTTHNDAIMFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.