* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-2-(2-METHYLBUTAN-2-YL)-1H-1,3-BENZODIAZOLE |
| English Synonyms: | 6-METHYL-2-(2-METHYLBUTAN-2-YL)-1H-1,3-BENZODIAZOLE |
| MDL Number.: | MFCD16844894 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(C)(C)c1[nH]c2cc(ccc2n1)C |
| InChi: | InChI=1S/C13H18N2/c1-5-13(3,4)12-14-10-7-6-9(2)8-11(10)15-12/h6-8H,5H2,1-4H3,(H,14,15) |
| InChiKey: | InChIKey=LIMBOBUQWFYHHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.