Molecular Structure:
CCD No.:CCD03225902
OTAVA-BB 1908125
Formula:C11 H16 N2 O2
MolWeight:208.259
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1908125 |
| English Synonyms： | OTAVA-BB 1908125 |
| MDL Number.： | MFCD16845831 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CN(CCN)Cc1ccc2c(c1)OCO2 |
| InChi： | InChI=1S/C11H16N2O2/c1-13(5-4-12)7-9-2-3-10-11(6-9)15-8-14-10/h2-3,6H,4-5,7-8,12H2,1H3 |
| InChiKey： | InChIKey=NDUWQCILQWNLNV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
