* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-3-(2-PROPOXYETHYL)-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE |
English Synonyms: | 6-CHLORO-3-(2-PROPOXYETHYL)-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE |
MDL Number.: | MFCD16847033 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCCOCCc1nnc2n1nc(cc2)Cl |
InChi: | InChI=1S/C10H13ClN4O/c1-2-6-16-7-5-10-13-12-9-4-3-8(11)14-15(9)10/h3-4H,2,5-7H2,1H3 |
InChiKey: | InChIKey=YLECLOQFBNXCFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.