* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-3-(2-PROPOXYETHYL)-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDINE |
| English Synonyms: | 7-CHLORO-3-(2-PROPOXYETHYL)-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDINE |
| MDL Number.: | MFCD16847034 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCCOCCc1nnc2n1cnc(c2)Cl |
| InChi: | InChI=1S/C10H13ClN4O/c1-2-4-16-5-3-9-13-14-10-6-8(11)12-7-15(9)10/h6-7H,2-5H2,1H3 |
| InChiKey: | InChIKey=PGCUBYOEIUMFLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.