* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-2-(2-PROPOXYETHYL)-1H-1,3-BENZODIAZOLE |
| English Synonyms: | 6-METHYL-2-(2-PROPOXYETHYL)-1H-1,3-BENZODIAZOLE |
| MDL Number.: | MFCD16847038 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCOCCc1[nH]c2cc(ccc2n1)C |
| InChi: | InChI=1S/C13H18N2O/c1-3-7-16-8-6-13-14-11-5-4-10(2)9-12(11)15-13/h4-5,9H,3,6-8H2,1-2H3,(H,14,15) |
| InChiKey: | InChIKey=HGPDUMZPTNKSSH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.