* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1-[(2-METHYLBUTYL)AMINO]ETHYL)BENZENE-1,3-DIOL |
| English Synonyms: | 4-(1-[(2-METHYLBUTYL)AMINO]ETHYL)BENZENE-1,3-DIOL |
| MDL Number.: | MFCD16848835 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | CCC(C)CNC(C)c1ccc(cc1O)O |
| InChi: | InChI=1S/C13H21NO2/c1-4-9(2)8-14-10(3)12-6-5-11(15)7-13(12)16/h5-7,9-10,14-16H,4,8H2,1-3H3 |
| InChiKey: | InChIKey=MIOKEVVKJZEEOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.