* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(2-[(2-METHYLBUTYL)AMINO]ETHYL)ANILINE |
| English Synonyms: | 4-(2-[(2-METHYLBUTYL)AMINO]ETHYL)ANILINE |
| MDL Number.: | MFCD16849466 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCC(C)CNCCc1ccc(cc1)N |
| InChi: | InChI=1S/C13H22N2/c1-3-11(2)10-15-9-8-12-4-6-13(14)7-5-12/h4-7,11,15H,3,8-10,14H2,1-2H3 |
| InChiKey: | InChIKey=QOODXSIKGBKUIB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.