* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-ETHYL-N-(2-METHYLBUTYL)-4,5-DIHYDRO-1,3-THIAZOL-2-AMINE |
| English Synonyms: | 4-ETHYL-N-(2-METHYLBUTYL)-4,5-DIHYDRO-1,3-THIAZOL-2-AMINE |
| MDL Number.: | MFCD16849526 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC1CSC(=N1)NCC(C)CC |
| InChi: | InChI=1S/C10H20N2S/c1-4-8(3)6-11-10-12-9(5-2)7-13-10/h8-9H,4-7H2,1-3H3,(H,11,12) |
| InChiKey: | InChIKey=UHZNRMQEXQUCOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.