* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-([1-(2-METHYLBUTYL)-1H-1,2,3,4-TETRAZOL-5-YL]SULFANYL)ACETIC ACID |
English Synonyms: | 2-([1-(2-METHYLBUTYL)-1H-1,2,3,4-TETRAZOL-5-YL]SULFANYL)ACETIC ACID |
MDL Number.: | MFCD16849536 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCC(C)Cn1c(nnn1)SCC(=O)O |
InChi: | InChI=1S/C8H14N4O2S/c1-3-6(2)4-12-8(9-10-11-12)15-5-7(13)14/h6H,3-5H2,1-2H3,(H,13,14) |
InChiKey: | InChIKey=BROBRYUSWOJQSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.