* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-N-(2-METHYLBUTYL)-1,2,5-THIADIAZOL-3-AMINE |
| English Synonyms: | 4-CHLORO-N-(2-METHYLBUTYL)-1,2,5-THIADIAZOL-3-AMINE |
| MDL Number.: | MFCD16849592 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(C)CNc1c(nsn1)Cl |
| InChi: | InChI=1S/C7H12ClN3S/c1-3-5(2)4-9-7-6(8)10-12-11-7/h5H,3-4H2,1-2H3,(H,9,11) |
| InChiKey: | InChIKey=DHUYPYOHXQHOBZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.