* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,5-DIMETHYL-1-(2-METHYLBUTYL)-1H-PYRROLE |
English Synonyms: | 2,5-DIMETHYL-1-(2-METHYLBUTYL)-1H-PYRROLE |
MDL Number.: | MFCD16849615 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCC(C)Cn1c(ccc1C)C |
InChi: | InChI=1S/C11H19N/c1-5-9(2)8-12-10(3)6-7-11(12)4/h6-7,9H,5,8H2,1-4H3 |
InChiKey: | InChIKey=FTGYJAFTYBSGBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.