* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-1-(2-METHYLBUTYL)-1,5-DIAZOCANE |
| English Synonyms: | 4-METHYL-1-(2-METHYLBUTYL)-1,5-DIAZOCANE |
| MDL Number.: | MFCD16849635 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(C)CN1CCCNC(CC1)C |
| InChi: | InChI=1S/C12H26N2/c1-4-11(2)10-14-8-5-7-13-12(3)6-9-14/h11-13H,4-10H2,1-3H3 |
| InChiKey: | InChIKey=CAQIGKQRVBHOON-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.