* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-ETHYL-3-METHYL-1-(2-METHYLBUTYL)-1,5-DIAZOCANE |
English Synonyms: | 6-ETHYL-3-METHYL-1-(2-METHYLBUTYL)-1,5-DIAZOCANE |
MDL Number.: | MFCD16849638 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC1CCN(CC(CN1)C)CC(C)CC |
InChi: | InChI=1S/C14H30N2/c1-5-12(3)10-16-8-7-14(6-2)15-9-13(4)11-16/h12-15H,5-11H2,1-4H3 |
InChiKey: | InChIKey=UZXGCABOCPYIPB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.