* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYL-1-(2-METHYLBUTYL)-4,5,6,7-TETRAHYDRO-1H-INDOL-4-AMINE |
| English Synonyms: | 2-METHYL-1-(2-METHYLBUTYL)-4,5,6,7-TETRAHYDRO-1H-INDOL-4-AMINE |
| MDL Number.: | MFCD16849655 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(C)Cn1c(cc2c1CCCC2N)C |
| InChi: | InChI=1S/C14H24N2/c1-4-10(2)9-16-11(3)8-12-13(15)6-5-7-14(12)16/h8,10,13H,4-7,9,15H2,1-3H3 |
| InChiKey: | InChIKey=VYHIZDLVGCUQAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.