* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(2-METHYLBUTYL)-4,5,6,7-TETRAHYDRO-1H-INDOL-4-AMINE |
| English Synonyms: | 1-(2-METHYLBUTYL)-4,5,6,7-TETRAHYDRO-1H-INDOL-4-AMINE |
| MDL Number.: | MFCD16849656 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(C)Cn1ccc2c1CCCC2N |
| InChi: | InChI=1S/C13H22N2/c1-3-10(2)9-15-8-7-11-12(14)5-4-6-13(11)15/h7-8,10,12H,3-6,9,14H2,1-2H3 |
| InChiKey: | InChIKey=TVJOEALNUOKPOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.