* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)CYCLOHEPTAN-1-AMINE |
English Synonyms: | 1-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)CYCLOHEPTAN-1-AMINE |
MDL Number.: | MFCD16850696 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1cnnc1C2(CCCCCC2)N |
InChi: | InChI=1S/C10H18N4/c1-14-8-12-13-9(14)10(11)6-4-2-3-5-7-10/h8H,2-7,11H2,1H3 |
InChiKey: | InChIKey=DLLGMCQUBRUFEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.