* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]ANILINE |
| English Synonyms: | 4-METHYL-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]ANILINE |
| MDL Number.: | MFCD16850706 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)NCc2nncn2C |
| InChi: | InChI=1S/C11H14N4/c1-9-3-5-10(6-4-9)12-7-11-14-13-8-15(11)2/h3-6,8,12H,7H2,1-2H3 |
| InChiKey: | InChIKey=LNOCODOVCOHBBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.