* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-([(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]AMINO)PHENOL |
| English Synonyms: | 4-([(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]AMINO)PHENOL |
| MDL Number.: | MFCD16850709 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cn1cnnc1CNc2ccc(cc2)O |
| InChi: | InChI=1S/C10H12N4O/c1-14-7-12-13-10(14)6-11-8-2-4-9(15)5-3-8/h2-5,7,11,15H,6H2,1H3 |
| InChiKey: | InChIKey=DAHXPWBWWBPXAI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.