* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]ANILINE |
| English Synonyms: | 4-CHLORO-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]ANILINE |
| MDL Number.: | MFCD16850718 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1CNc2ccc(cc2)Cl |
| InChi: | InChI=1S/C10H11ClN4/c1-15-7-13-14-10(15)6-12-9-4-2-8(11)3-5-9/h2-5,7,12H,6H2,1H3 |
| InChiKey: | InChIKey=OFNPAZIIJJDLPO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.