* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)-1,2,3,4-TETRAHYDROISOQUINOLINE |
| English Synonyms: | 3-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)-1,2,3,4-TETRAHYDROISOQUINOLINE |
| MDL Number.: | MFCD16850759 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1C2Cc3ccccc3CN2 |
| InChi: | InChI=1S/C12H14N4/c1-16-8-14-15-12(16)11-6-9-4-2-3-5-10(9)7-13-11/h2-5,8,11,13H,6-7H2,1H3 |
| InChiKey: | InChIKey=HOOLMCILQRTPGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.