* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,5-DIMETHYL-3-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)THIOPHEN-2-AMINE |
English Synonyms: | 4,5-DIMETHYL-3-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)THIOPHEN-2-AMINE |
MDL Number.: | MFCD16850764 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1c(sc(c1c2nncn2C)N)C |
InChi: | InChI=1S/C9H12N4S/c1-5-6(2)14-8(10)7(5)9-12-11-4-13(9)3/h4H,10H2,1-3H3 |
InChiKey: | InChIKey=GUVRRCFBNVYTFQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.