* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-AMINO-2-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)PHENOL |
English Synonyms: | 5-AMINO-2-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)PHENOL |
MDL Number.: | MFCD16850769 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cnnc1c2ccc(cc2O)N |
InChi: | InChI=1S/C9H10N4O/c1-13-5-11-12-9(13)7-3-2-6(10)4-8(7)14/h2-5,14H,10H2,1H3 |
InChiKey: | InChIKey=DWCCSHNIYNRTFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.