* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHEN-2-AMINE |
| English Synonyms: | 3-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHEN-2-AMINE |
| MDL Number.: | MFCD16850773 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1c2c3c(sc2N)CCCC3 |
| InChi: | InChI=1S/C11H14N4S/c1-15-6-13-14-11(15)9-7-4-2-3-5-8(7)16-10(9)12/h6H,2-5,12H2,1H3 |
| InChiKey: | InChIKey=UPZYIAPFNGISPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.