* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL[1-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)PROPYL]AMINE |
| English Synonyms: | METHYL[1-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)PROPYL]AMINE |
| MDL Number.: | MFCD16850785 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCC(c1nncn1C)NC |
| InChi: | InChI=1S/C7H14N4/c1-4-6(8-2)7-10-9-5-11(7)3/h5-6,8H,4H2,1-3H3 |
| InChiKey: | InChIKey=WWCPEVBYZUWWIP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.