* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-3-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-4-YL)-4H-1,2,4-TRIAZOLE |
| English Synonyms: | 4-METHYL-3-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-4-YL)-4H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD16850791 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1C2c3ccsc3CCN2 |
| InChi: | InChI=1S/C10H12N4S/c1-14-6-12-13-10(14)9-7-3-5-15-8(7)2-4-11-9/h3,5-6,9,11H,2,4H2,1H3 |
| InChiKey: | InChIKey=WQQVIPSTJREQAM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.