* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)BENZOIC ACID |
English Synonyms: | 2-(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)BENZOIC ACID |
MDL Number.: | MFCD16850794 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1cnnc1c2ccccc2C(=O)O |
InChi: | InChI=1S/C10H9N3O2/c1-13-6-11-12-9(13)7-4-2-3-5-8(7)10(14)15/h2-6H,1H3,(H,14,15) |
InChiKey: | InChIKey=PQSIERKWMDWLQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.