* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)THIOPHEN-2-AMINE |
English Synonyms: | 5-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)THIOPHEN-2-AMINE |
MDL Number.: | MFCD16850810 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1cnnc1c2ccc(s2)N |
InChi: | InChI=1S/C8H10N4S/c1-2-12-5-10-11-8(12)6-3-4-7(9)13-6/h3-5H,2,9H2,1H3 |
InChiKey: | InChIKey=ZSDFHRWSCBVQHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.