* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL[(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]AMINE |
| English Synonyms: | ETHYL[(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]AMINE |
| MDL Number.: | MFCD16850815 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCNCc1nncn1CC |
| InChi: | InChI=1S/C7H14N4/c1-3-8-5-7-10-9-6-11(7)4-2/h6,8H,3-5H2,1-2H3 |
| InChiKey: | InChIKey=AJAXYQKBACRDSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.