* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-ETHYL-3-(PYRROLIDIN-2-YL)-4H-1,2,4-TRIAZOLE |
| English Synonyms: | 4-ETHYL-3-(PYRROLIDIN-2-YL)-4H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD16850855 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCn1cnnc1C2CCCN2 |
| InChi: | InChI=1S/C8H14N4/c1-2-12-6-10-11-8(12)7-4-3-5-9-7/h6-7,9H,2-5H2,1H3 |
| InChiKey: | InChIKey=MLDQJIGXUCEOJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.