* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL[2-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)ETHYL]AMINE |
English Synonyms: | ETHYL[2-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)ETHYL]AMINE |
MDL Number.: | MFCD16850866 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCCc1nncn1CC |
InChi: | InChI=1S/C8H16N4/c1-3-9-6-5-8-11-10-7-12(8)4-2/h7,9H,3-6H2,1-2H3 |
InChiKey: | InChIKey=FIIWSTWIQOFLDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.