* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)BUTANOIC ACID |
| English Synonyms: | 4-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)BUTANOIC ACID |
| MDL Number.: | MFCD16850917 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCn1cnnc1CCCC(=O)O |
| InChi: | InChI=1S/C8H13N3O2/c1-2-11-6-9-10-7(11)4-3-5-8(12)13/h6H,2-5H2,1H3,(H,12,13) |
| InChiKey: | InChIKey=YNDRZVYJMYYUPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.