* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)PENTANOIC ACID |
English Synonyms: | 5-(4-ETHYL-4H-1,2,4-TRIAZOL-3-YL)PENTANOIC ACID |
MDL Number.: | MFCD16850921 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cnnc1CCCCC(=O)O |
InChi: | InChI=1S/C9H15N3O2/c1-2-12-7-10-11-8(12)5-3-4-6-9(13)14/h7H,2-6H2,1H3,(H,13,14) |
InChiKey: | InChIKey=LBOLBGPNXDKYSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.